C26H21F3N2O — CID 102043928
4-[1-(4-aminophenyl)-2,2,2-trifluoro-1-(4-phenoxyphenyl)ethyl]aniline (PubChem CID 102043928) has the molecular formula C26H21F3N2O and a molecular weight of 434.46 g/mol. Its IUPAC name is 4-[1-(4-aminophenyl)-2,2,2-trifluoro-1-(4-phenoxyphenyl)ethyl]aniline.
| Compound Name | 4-[1-(4-aminophenyl)-2,2,2-trifluoro-1-(4-phenoxyphenyl)ethyl]aniline |
|---|---|
| PubChem CID | 102043928 |
| Molecular Formula | C26H21F3N2O |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 4-[1-(4-aminophenyl)-2,2,2-trifluoro-1-(4-phenoxyphenyl)ethyl]aniline |
| SMILES | Nc1ccc(C(c2ccc(N)cc2)(c2ccc(Oc3ccccc3)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H21F3N2O/c27-26(28,29)25(18-6-12-21(30)13-7-18,19-8-14-22(31)15-9-19)20-10-16-24(17-11-20)32-23-4-2-1-3-5-23/h1-17H,30-31H2 |
| InChIKey | NPGPTSAQTXAQFY-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|