C15H13F6NO — CID 175083375
1,1,1,2,2,3-hexafluoropropane;4-phenoxyaniline (PubChem CID 175083375) has the molecular formula C15H13F6NO and a molecular weight of 337.26 g/mol. Its IUPAC name is 1,1,1,2,2,3-hexafluoropropane;4-phenoxyaniline.
| Compound Name | 1,1,1,2,2,3-hexafluoropropane;4-phenoxyaniline |
|---|---|
| PubChem CID | 175083375 |
| Molecular Formula | C15H13F6NO |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 1,1,1,2,2,3-hexafluoropropane;4-phenoxyaniline |
| SMILES | FCC(F)(F)C(F)(F)F.Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11NO.C3H2F6/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11;4-1-2(5,6)3(7,8)9/h1-9H,13H2;1H2 |
| InChIKey | OJSFOZWWMWGDBP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|