C9H8F6 — CID 174871596
benzene;1,1,1,2,2,3-hexafluoropropane (PubChem CID 174871596) has the molecular formula C9H8F6 and a molecular weight of 230.15 g/mol. Its IUPAC name is benzene;1,1,1,2,2,3-hexafluoropropane.
| Compound Name | benzene;1,1,1,2,2,3-hexafluoropropane |
|---|---|
| PubChem CID | 174871596 |
| Molecular Formula | C9H8F6 |
| Molecular Weight | 230.15 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | benzene;1,1,1,2,2,3-hexafluoropropane |
| SMILES | FCC(F)(F)C(F)(F)F.c1ccccc1 |
| InChI | InChI=1S/C6H6.C3H2F6/c1-2-4-6-5-3-1;4-1-2(5,6)3(7,8)9/h1-6H;1H2 |
| InChIKey | FPHLYOAHUIULGC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.15 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|