C10H8F14 — CID 607523
1,1,1,2,2,5,5,6,6,9,9,10,10,10-tetradecafluorodecane (PubChem CID 607523) has the molecular formula C10H8F14 and a molecular weight of 394.15 g/mol. Its IUPAC name is 1,1,1,2,2,5,5,6,6,9,9,10,10,10-tetradecafluorodecane.
| Compound Name | 1,1,1,2,2,5,5,6,6,9,9,10,10,10-tetradecafluorodecane |
|---|---|
| PubChem CID | 607523 |
| Molecular Formula | C10H8F14 |
| Molecular Weight | 394.15 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 1,1,1,2,2,5,5,6,6,9,9,10,10,10-tetradecafluorodecane |
| SMILES | FC(F)(F)C(F)(F)CCC(F)(F)C(F)(F)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H8F14/c11-5(12,1-3-7(15,16)9(19,20)21)6(13,14)2-4-8(17,18)10(22,23)24/h1-4H2 |
| InChIKey | QXWQGHYZCQGSOD-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.15 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|