C5H6F5NaS — CID 59109811
sodium 4,4,5,5,5-pentafluoropentane-1-thiolate (PubChem CID 59109811) has the molecular formula C5H6F5NaS and a molecular weight of 216.15 g/mol. Its IUPAC name is sodium 4,4,5,5,5-pentafluoropentane-1-thiolate.
| Compound Name | sodium 4,4,5,5,5-pentafluoropentane-1-thiolate |
|---|---|
| PubChem CID | 59109811 |
| Molecular Formula | C5H6F5NaS |
| Molecular Weight | 216.15 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | sodium 4,4,5,5,5-pentafluoropentane-1-thiolate |
| SMILES | FC(F)(F)C(F)(F)CCC[S-].[Na+] |
| InChI | InChI=1S/C5H7F5S.Na/c6-4(7,2-1-3-11)5(8,9)10;/h11H,1-3H2;/q;+1/p-1 |
| InChIKey | KSGIGZOJNWXCMV-UHFFFAOYSA-M |
| XLogP | -0.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.15 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|