C16H28F10N2Si — CID 172706114
8-[diamino(7,7,8,8,8-pentafluorooctyl)silyl]-1,1,1,2,2-pentafluorooctane (PubChem CID 172706114) has the molecular formula C16H28F10N2Si and a molecular weight of 466.48 g/mol. Its IUPAC name is 8-[diamino(7,7,8,8,8-pentafluorooctyl)silyl]-1,1,1,2,2-pentafluorooctane.
| Compound Name | 8-[diamino(7,7,8,8,8-pentafluorooctyl)silyl]-1,1,1,2,2-pentafluorooctane |
|---|---|
| PubChem CID | 172706114 |
| Molecular Formula | C16H28F10N2Si |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 8-[diamino(7,7,8,8,8-pentafluorooctyl)silyl]-1,1,1,2,2-pentafluorooctane |
| SMILES | N[Si](N)(CCCCCCC(F)(F)C(F)(F)F)CCCCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H28F10N2Si/c17-13(18,15(21,22)23)9-5-1-3-7-11-29(27,28)12-8-4-2-6-10-14(19,20)16(24,25)26/h1-12,27-28H2 |
| InChIKey | DPMJRBMXXBFHHN-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|