C14H20F14N2Si — CID 172778542
7-[diamino(5,5,6,6,7,7,7-heptafluoroheptyl)silyl]-1,1,1,2,2,3,3-heptafluoroheptane (PubChem CID 172778542) has the molecular formula C14H20F14N2Si and a molecular weight of 510.39 g/mol. Its IUPAC name is 7-[diamino(5,5,6,6,7,7,7-heptafluoroheptyl)silyl]-1,1,1,2,2,3,3-heptafluoroheptane.
| Compound Name | 7-[diamino(5,5,6,6,7,7,7-heptafluoroheptyl)silyl]-1,1,1,2,2,3,3-heptafluoroheptane |
|---|---|
| PubChem CID | 172778542 |
| Molecular Formula | C14H20F14N2Si |
| Molecular Weight | 510.39 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 7-[diamino(5,5,6,6,7,7,7-heptafluoroheptyl)silyl]-1,1,1,2,2,3,3-heptafluoroheptane |
| SMILES | N[Si](N)(CCCCC(F)(F)C(F)(F)C(F)(F)F)CCCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H20F14N2Si/c15-9(16,11(19,20)13(23,24)25)5-1-3-7-31(29,30)8-4-2-6-10(17,18)12(21,22)14(26,27)28/h1-8,29-30H2 |
| InChIKey | NXZGHZVICFQBOD-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.39 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|