C18H20F22N2Si — CID 172693131
9-[diamino(5,5,6,6,7,7,8,8,9,9,9-undecafluorononyl)silyl]-1,1,1,2,2,3,3,4,4,5,5-undecafluorononane (PubChem CID 172693131) has the molecular formula C18H20F22N2Si and a molecular weight of 710.41 g/mol. Its IUPAC name is 9-[diamino(5,5,6,6,7,7,8,8,9,9,9-undecafluorononyl)silyl]-1,1,1,2,2,3,3,4,4,5,5-undecafluorononane.
| Compound Name | 9-[diamino(5,5,6,6,7,7,8,8,9,9,9-undecafluorononyl)silyl]-1,1,1,2,2,3,3,4,4,5,5-undecafluorononane |
|---|---|
| PubChem CID | 172693131 |
| Molecular Formula | C18H20F22N2Si |
| Molecular Weight | 710.41 g/mol |
| Exact Mass | 710.10 |
| IUPAC Name | 9-[diamino(5,5,6,6,7,7,8,8,9,9,9-undecafluorononyl)silyl]-1,1,1,2,2,3,3,4,4,5,5-undecafluorononane |
| SMILES | N[Si](N)(CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H20F22N2Si/c19-9(20,11(23,24)13(27,28)15(31,32)17(35,36)37)5-1-3-7-43(41,42)8-4-2-6-10(21,22)12(25,26)14(29,30)16(33,34)18(38,39)40/h1-8,41-42H2 |
| InChIKey | BYKHHTLQKAINJE-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.41 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|