C14H12F22N2Si — CID 172814135
7-[diamino(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silyl]-1,1,1,2,2,3,3,4,4,5,5-undecafluoroheptane (PubChem CID 172814135) has the molecular formula C14H12F22N2Si and a molecular weight of 654.31 g/mol. Its IUPAC name is 7-[diamino(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silyl]-1,1,1,2,2,3,3,4,4,5,5-undecafluoroheptane.
| Compound Name | 7-[diamino(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silyl]-1,1,1,2,2,3,3,4,4,5,5-undecafluoroheptane |
|---|---|
| PubChem CID | 172814135 |
| Molecular Formula | C14H12F22N2Si |
| Molecular Weight | 654.31 g/mol |
| Exact Mass | 654.04 |
| IUPAC Name | 7-[diamino(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silyl]-1,1,1,2,2,3,3,4,4,5,5-undecafluoroheptane |
| SMILES | N[Si](N)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F22N2Si/c15-5(16,7(19,20)9(23,24)11(27,28)13(31,32)33)1-3-39(37,38)4-2-6(17,18)8(21,22)10(25,26)12(29,30)14(34,35)36/h1-4,37-38H2 |
| InChIKey | SOWUPIYYWRECRP-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.31 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|