C9H6F15N — CID 154642605
3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononan-1-amine (PubChem CID 154642605) has the molecular formula C9H6F15N and a molecular weight of 413.12 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononan-1-amine.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononan-1-amine |
|---|---|
| PubChem CID | 154642605 |
| Molecular Formula | C9H6F15N |
| Molecular Weight | 413.12 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononan-1-amine |
| SMILES | NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F15N/c10-3(11,1-2-25)4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)24/h1-2,25H2 |
| InChIKey | YURFMHYJPFWKNL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.12 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|