C10H12F12N2 — CID 15061690
3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodecane-1,10-diamine (PubChem CID 15061690) has the molecular formula C10H12F12N2 and a molecular weight of 388.20 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodecane-1,10-diamine.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodecane-1,10-diamine |
|---|---|
| PubChem CID | 15061690 |
| Molecular Formula | C10H12F12N2 |
| Molecular Weight | 388.20 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodecane-1,10-diamine |
| SMILES | NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCN |
| InChI | InChI=1S/C10H12F12N2/c11-5(12,1-3-23)7(15,16)9(19,20)10(21,22)8(17,18)6(13,14)2-4-24/h1-4,23-24H2 |
| InChIKey | OJJYXBAVUNNBGO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.20 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|