C16H28F8N2 — CID 121403391
N'-(4,4,5,5,6,6,7,7-octafluorotetradecyl)ethane-1,2-diamine (PubChem CID 121403391) has the molecular formula C16H28F8N2 and a molecular weight of 400.40 g/mol. Its IUPAC name is N'-(4,4,5,5,6,6,7,7-octafluorotetradecyl)ethane-1,2-diamine.
| Compound Name | N'-(4,4,5,5,6,6,7,7-octafluorotetradecyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 121403391 |
| Molecular Formula | C16H28F8N2 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | N'-(4,4,5,5,6,6,7,7-octafluorotetradecyl)ethane-1,2-diamine |
| SMILES | CCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCNCCN |
| InChI | InChI=1S/C16H28F8N2/c1-2-3-4-5-6-8-13(17,18)15(21,22)16(23,24)14(19,20)9-7-11-26-12-10-25/h26H,2-12,25H2,1H3 |
| InChIKey | YHLOIHKVPLNQNU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|