C7H12F6N2 — CID 170615056
3,3,4,4,5,5-hexafluoroheptane-1,7-diamine (PubChem CID 170615056) has the molecular formula C7H12F6N2 and a molecular weight of 238.17 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoroheptane-1,7-diamine.
| Compound Name | 3,3,4,4,5,5-hexafluoroheptane-1,7-diamine |
|---|---|
| PubChem CID | 170615056 |
| Molecular Formula | C7H12F6N2 |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoroheptane-1,7-diamine |
| SMILES | NCCC(F)(F)C(F)(F)C(F)(F)CCN |
| InChI | InChI=1S/C7H12F6N2/c8-5(9,1-3-14)7(12,13)6(10,11)2-4-15/h1-4,14-15H2 |
| InChIKey | XAHPQTQNUDTDFE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|