C5H9ClF6N2 — CID 54599144
2,2,3,3,4,4-hexafluoropentane-1,5-diamine;hydrochloride (PubChem CID 54599144) has the molecular formula C5H9ClF6N2 and a molecular weight of 246.58 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoropentane-1,5-diamine;hydrochloride.
| Compound Name | 2,2,3,3,4,4-hexafluoropentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 54599144 |
| Molecular Formula | C5H9ClF6N2 |
| Molecular Weight | 246.58 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoropentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCC(F)(F)C(F)(F)C(F)(F)CN |
| InChI | InChI=1S/C5H8F6N2.ClH/c6-3(7,1-12)5(10,11)4(8,9)2-13;/h1-2,12-13H2;1H |
| InChIKey | FQZJPZCVPBCCIQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.58 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|