C8H16F7N3Si — CID 150546986
1,1,1,2,2,3,3-heptafluoro-8-triaminosilyloctane (PubChem CID 150546986) has the molecular formula C8H16F7N3Si and a molecular weight of 315.31 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-8-triaminosilyloctane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-8-triaminosilyloctane |
|---|---|
| PubChem CID | 150546986 |
| Molecular Formula | C8H16F7N3Si |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-8-triaminosilyloctane |
| SMILES | N[Si](N)(N)CCCCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H16F7N3Si/c9-6(10,7(11,12)8(13,14)15)4-2-1-3-5-19(16,17)18/h1-5,16-18H2 |
| InChIKey | IHBKUNSACDSUIF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|