C12H10F12O2 — CID 146309216
4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorododecanedial (PubChem CID 146309216) has the molecular formula C12H10F12O2 and a molecular weight of 414.19 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorododecanedial.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorododecanedial |
|---|---|
| PubChem CID | 146309216 |
| Molecular Formula | C12H10F12O2 |
| Molecular Weight | 414.19 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorododecanedial |
| SMILES | O=CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC=O |
| InChI | InChI=1S/C12H10F12O2/c13-7(14,3-1-5-25)9(17,18)11(21,22)12(23,24)10(19,20)8(15,16)4-2-6-26/h5-6H,1-4H2 |
| InChIKey | IJXIPBVKFULHMQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.19 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|