C13H14F12O — CID 11015174
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorotridecanal (PubChem CID 11015174) has the molecular formula C13H14F12O and a molecular weight of 414.23 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorotridecanal.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorotridecanal |
|---|---|
| PubChem CID | 11015174 |
| Molecular Formula | C13H14F12O |
| Molecular Weight | 414.23 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorotridecanal |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C=O |
| InChI | InChI=1S/C13H14F12O/c1-2-3-4-5-6-8(14,15)10(18,19)12(22,23)13(24,25)11(20,21)9(16,17)7-26/h7H,2-6H2,1H3 |
| InChIKey | JUNVFXWLAKFKCP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.23 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|