C19H22F16 — CID 123318581
5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-hexadecafluorononadec-3-ene (PubChem CID 123318581) has the molecular formula C19H22F16 and a molecular weight of 554.35 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-hexadecafluorononadec-3-ene.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-hexadecafluorononadec-3-ene |
|---|---|
| PubChem CID | 123318581 |
| Molecular Formula | C19H22F16 |
| Molecular Weight | 554.35 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-hexadecafluorononadec-3-ene |
| SMILES | CCC=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCCCC |
| InChI | InChI=1S/C19H22F16/c1-3-5-7-8-9-11-13(22,23)15(26,27)17(30,31)19(34,35)18(32,33)16(28,29)14(24,25)12(20,21)10-6-4-2/h6,10H,3-5,7-9,11H2,1-2H3 |
| InChIKey | LMVATEDYVVLESY-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.35 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|