C20H24F16 — CID 89419217
(E)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluoroicos-2-ene (PubChem CID 89419217) has the molecular formula C20H24F16 and a molecular weight of 568.38 g/mol. Its IUPAC name is (E)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluoroicos-2-ene.
| Compound Name | (E)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluoroicos-2-ene |
|---|---|
| PubChem CID | 89419217 |
| Molecular Formula | C20H24F16 |
| Molecular Weight | 568.38 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | (E)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluoroicos-2-ene |
| SMILES | C/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCCCCCC |
| InChI | InChI=1S/C20H24F16/c1-3-5-6-7-8-9-10-12-14(23,24)16(27,28)18(31,32)20(35,36)19(33,34)17(29,30)15(25,26)13(21,22)11-4-2/h4,11H,3,5-10,12H2,1-2H3/b11-4+ |
| InChIKey | ZYZQTQCEKPVZST-NYYWCZLTSA-N |
| XLogP | 9.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.38 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|