C12H14F10O — CID 121403461
(E)-3,3,4,4,5,5,6,6,7,7-decafluorododec-10-en-1-ol (PubChem CID 121403461) has the molecular formula C12H14F10O and a molecular weight of 364.22 g/mol. Its IUPAC name is (E)-3,3,4,4,5,5,6,6,7,7-decafluorododec-10-en-1-ol.
| Compound Name | (E)-3,3,4,4,5,5,6,6,7,7-decafluorododec-10-en-1-ol |
|---|---|
| PubChem CID | 121403461 |
| Molecular Formula | C12H14F10O |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | (E)-3,3,4,4,5,5,6,6,7,7-decafluorododec-10-en-1-ol |
| SMILES | C/C=C/CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCO |
| InChI | InChI=1S/C12H14F10O/c1-2-3-4-5-8(13,14)10(17,18)12(21,22)11(19,20)9(15,16)6-7-23/h2-3,23H,4-7H2,1H3/b3-2+ |
| InChIKey | HNFSHMPSPFGHSO-NSCUHMNNSA-N |
| XLogP | 4.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|