C16H7F23O — CID 140934909
3,3,4,4,5,5,6,6,7,7,8,11,12,12,13,13,14,14,15,15,16,16,16-tricosafluorohexadeca-8,10-dien-1-ol (PubChem CID 140934909) has the molecular formula C16H7F23O and a molecular weight of 652.18 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,11,12,12,13,13,14,14,15,15,16,16,16-tricosafluorohexadeca-8,10-dien-1-ol.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,11,12,12,13,13,14,14,15,15,16,16,16-tricosafluorohexadeca-8,10-dien-1-ol |
|---|---|
| PubChem CID | 140934909 |
| Molecular Formula | C16H7F23O |
| Molecular Weight | 652.18 g/mol |
| Exact Mass | 652.01 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,11,12,12,13,13,14,14,15,15,16,16,16-tricosafluorohexadeca-8,10-dien-1-ol |
| SMILES | OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)=CC=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H7F23O/c17-5(8(21,22)11(27,28)13(31,32)10(25,26)7(19,20)3-4-40)1-2-6(18)9(23,24)12(29,30)14(33,34)15(35,36)16(37,38)39/h1-2,40H,3-4H2 |
| InChIKey | XBDPREUKFRKVBL-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.18 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|