C8H10F8OS — CID 87063801
3,3,4,4,5,5,6,6-octafluoro-8-sulfanyloctan-1-ol (PubChem CID 87063801) has the molecular formula C8H10F8OS and a molecular weight of 306.22 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6-octafluoro-8-sulfanyloctan-1-ol.
| Compound Name | 3,3,4,4,5,5,6,6-octafluoro-8-sulfanyloctan-1-ol |
|---|---|
| PubChem CID | 87063801 |
| Molecular Formula | C8H10F8OS |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 3,3,4,4,5,5,6,6-octafluoro-8-sulfanyloctan-1-ol |
| SMILES | OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCS |
| InChI | InChI=1S/C8H10F8OS/c9-5(10,1-3-17)7(13,14)8(15,16)6(11,12)2-4-18/h17-18H,1-4H2 |
| InChIKey | LOPQESBCZBYWAD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|