C7H5F11S — CID 54019533
3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexane-1-thiol (PubChem CID 54019533) has the molecular formula C7H5F11S and a molecular weight of 330.16 g/mol. Its IUPAC name is 3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexane-1-thiol.
| Compound Name | 3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexane-1-thiol |
|---|---|
| PubChem CID | 54019533 |
| Molecular Formula | C7H5F11S |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexane-1-thiol |
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)CCS |
| InChI | InChI=1S/C7H5F11S/c8-3(9,1-2-19)5(11,12)4(10,6(13,14)15)7(16,17)18/h19H,1-2H2 |
| InChIKey | KXZAPGZNPQWWTG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|