C17H18F22O8S2 — CID 87329577
bis(3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexane-1-sulfonic acid);propane-1,2-diol (PubChem CID 87329577) has the molecular formula C17H18F22O8S2 and a molecular weight of 832.41 g/mol. Its IUPAC name is bis(3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexane-1-sulfonic acid);propane-1,2-diol.
| Compound Name | bis(3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexane-1-sulfonic acid);propane-1,2-diol |
|---|---|
| PubChem CID | 87329577 |
| Molecular Formula | C17H18F22O8S2 |
| Molecular Weight | 832.41 g/mol |
| Exact Mass | 832.01 |
| IUPAC Name | bis(3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexane-1-sulfonic acid);propane-1,2-diol |
| SMILES | CC(O)CO.O=S(=O)(O)CCC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F.O=S(=O)(O)CCC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/2C7H5F11O3S.C3H8O2/c2*8-3(9,1-2-22(19,20)21)5(11,12)4(10,6(13,14)15)7(16,17)18;1-3(5)2-4/h2*1-2H2,(H,19,20,21);3-5H,2H2,1H3 |
| InChIKey | JHZYFSMKIIURAR-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.41 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|