C13H9F19O2 — CID 139903405
5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-hexadecafluoro-11-(trifluoromethyl)dodecane-1,2-diol (PubChem CID 139903405) has the molecular formula C13H9F19O2 and a molecular weight of 558.18 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-hexadecafluoro-11-(trifluoromethyl)dodecane-1,2-diol.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-hexadecafluoro-11-(trifluoromethyl)dodecane-1,2-diol |
|---|---|
| PubChem CID | 139903405 |
| Molecular Formula | C13H9F19O2 |
| Molecular Weight | 558.18 g/mol |
| Exact Mass | 558.03 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-hexadecafluoro-11-(trifluoromethyl)dodecane-1,2-diol |
| SMILES | OCC(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H9F19O2/c14-5(15,2-1-4(34)3-33)7(17,18)9(21,22)11(25,26)10(23,24)8(19,20)6(16,12(27,28)29)13(30,31)32/h4,33-34H,1-3H2 |
| InChIKey | LVZWZMRPFDMEDR-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.18 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|