C10H2F20O — CID 87915651
1,2,2,3,4,4,5,5,6,6,7,8,8,8-tetradecafluoro-3,7-bis(trifluoromethyl)octan-1-ol (PubChem CID 87915651) has the molecular formula C10H2F20O and a molecular weight of 518.09 g/mol. Its IUPAC name is 1,2,2,3,4,4,5,5,6,6,7,8,8,8-tetradecafluoro-3,7-bis(trifluoromethyl)octan-1-ol.
| Compound Name | 1,2,2,3,4,4,5,5,6,6,7,8,8,8-tetradecafluoro-3,7-bis(trifluoromethyl)octan-1-ol |
|---|---|
| PubChem CID | 87915651 |
| Molecular Formula | C10H2F20O |
| Molecular Weight | 518.09 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | 1,2,2,3,4,4,5,5,6,6,7,8,8,8-tetradecafluoro-3,7-bis(trifluoromethyl)octan-1-ol |
| SMILES | OC(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H2F20O/c11-1(31)2(12,13)3(14,8(22,23)24)5(16,17)7(20,21)6(18,19)4(15,9(25,26)27)10(28,29)30/h1,31H |
| InChIKey | GNAQRYHLIUDGSG-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.09 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|