C14H7F23O — CID 54278235
4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,13,13,13-icosafluoro-11-(trifluoromethyl)tridecan-2-ol (PubChem CID 54278235) has the molecular formula C14H7F23O and a molecular weight of 628.16 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,13,13,13-icosafluoro-11-(trifluoromethyl)tridecan-2-ol.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,13,13,13-icosafluoro-11-(trifluoromethyl)tridecan-2-ol |
|---|---|
| PubChem CID | 54278235 |
| Molecular Formula | C14H7F23O |
| Molecular Weight | 628.16 g/mol |
| Exact Mass | 628.01 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,13,13,13-icosafluoro-11-(trifluoromethyl)tridecan-2-ol |
| SMILES | CC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H7F23O/c1-3(38)2-4(15,16)6(18,19)9(24,25)11(28,29)12(30,31)10(26,27)7(20,21)5(17,13(32,33)34)8(22,23)14(35,36)37/h3,38H,2H2,1H3 |
| InChIKey | MOCHRYLJZYLZPG-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.16 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|