C10H7F13O3 — CID 170053475
(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-hydroxyoctyl) acetate (PubChem CID 170053475) has the molecular formula C10H7F13O3 and a molecular weight of 422.14 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-hydroxyoctyl) acetate.
| Compound Name | (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-hydroxyoctyl) acetate |
|---|---|
| PubChem CID | 170053475 |
| Molecular Formula | C10H7F13O3 |
| Molecular Weight | 422.14 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-hydroxyoctyl) acetate |
| SMILES | CC(=O)OC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H7F13O3/c1-3(24)26-4(25)2-5(11,12)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)23/h4,25H,2H2,1H3 |
| InChIKey | JLZIESZDRDGBAW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.14 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|