C9H8ClF9O2 — CID 133065141
(1-chloro-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-yl) acetate (PubChem CID 133065141) has the molecular formula C9H8ClF9O2 and a molecular weight of 354.60 g/mol. Its IUPAC name is (1-chloro-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-yl) acetate.
| Compound Name | (1-chloro-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-yl) acetate |
|---|---|
| PubChem CID | 133065141 |
| Molecular Formula | C9H8ClF9O2 |
| Molecular Weight | 354.60 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | (1-chloro-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-yl) acetate |
| SMILES | CC(=O)OC(CCl)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8ClF9O2/c1-4(20)21-5(3-10)2-6(11,12)7(13,14)8(15,16)9(17,18)19/h5H,2-3H2,1H3 |
| InChIKey | CTIXETCISASXEO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|