C17H18F15NO3 — CID 58855508
(4,4,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoro-1-morpholin-4-ylundecan-2-yl) acetate (PubChem CID 58855508) has the molecular formula C17H18F15NO3 and a molecular weight of 569.31 g/mol. Its IUPAC name is (4,4,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoro-1-morpholin-4-ylundecan-2-yl) acetate.
| Compound Name | (4,4,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoro-1-morpholin-4-ylundecan-2-yl) acetate |
|---|---|
| PubChem CID | 58855508 |
| Molecular Formula | C17H18F15NO3 |
| Molecular Weight | 569.31 g/mol |
| Exact Mass | 569.10 |
| IUPAC Name | (4,4,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoro-1-morpholin-4-ylundecan-2-yl) acetate |
| SMILES | CC(=O)OC(CN1CCOCC1)CC(F)(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H18F15NO3/c1-9(34)36-10(7-33-2-4-35-5-3-33)6-11(18,19)8-12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)32/h10H,2-8H2,1H3 |
| InChIKey | VLLZULTVPGOMII-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.31 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|