C16H23F8NO4 — CID 58855462
[1-morpholin-4-yl-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-yl] butanoate (PubChem CID 58855462) has the molecular formula C16H23F8NO4 and a molecular weight of 445.35 g/mol. Its IUPAC name is [1-morpholin-4-yl-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-yl] butanoate.
| Compound Name | [1-morpholin-4-yl-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-yl] butanoate |
|---|---|
| PubChem CID | 58855462 |
| Molecular Formula | C16H23F8NO4 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | [1-morpholin-4-yl-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-yl] butanoate |
| SMILES | CCCC(=O)OC(COCC(F)(F)C(F)(F)C(F)(F)C(F)F)CN1CCOCC1 |
| InChI | InChI=1S/C16H23F8NO4/c1-2-3-12(26)29-11(8-25-4-6-27-7-5-25)9-28-10-14(19,20)16(23,24)15(21,22)13(17)18/h11,13H,2-10H2,1H3 |
| InChIKey | JXYGHWBDWRDRTL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|