C9H11F8NO3 — CID 170872803
3-amino-4-(2,2,3,3,4,4,5,5-octafluoropentoxy)butanoic acid (PubChem CID 170872803) has the molecular formula C9H11F8NO3 and a molecular weight of 333.18 g/mol. Its IUPAC name is 3-amino-4-(2,2,3,3,4,4,5,5-octafluoropentoxy)butanoic acid.
| Compound Name | 3-amino-4-(2,2,3,3,4,4,5,5-octafluoropentoxy)butanoic acid |
|---|---|
| PubChem CID | 170872803 |
| Molecular Formula | C9H11F8NO3 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 3-amino-4-(2,2,3,3,4,4,5,5-octafluoropentoxy)butanoic acid |
| SMILES | NC(COCC(F)(F)C(F)(F)C(F)(F)C(F)F)CC(=O)O |
| InChI | InChI=1S/C9H11F8NO3/c10-6(11)8(14,15)9(16,17)7(12,13)3-21-2-4(18)1-5(19)20/h4,6H,1-3,18H2,(H,19,20) |
| InChIKey | XFYLDHCVOICOPG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|