C13H18F8O2 — CID 166810499
2,2,3,3,4,4,5,5-octafluoropentyl 2,2,3,3-tetramethylbutanoate (PubChem CID 166810499) has the molecular formula C13H18F8O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl 2,2,3,3-tetramethylbutanoate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2,2,3,3-tetramethylbutanoate |
|---|---|
| PubChem CID | 166810499 |
| Molecular Formula | C13H18F8O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2,2,3,3-tetramethylbutanoate |
| SMILES | CC(C)(C)C(C)(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H18F8O2/c1-9(2,3)10(4,5)8(22)23-6-11(16,17)13(20,21)12(18,19)7(14)15/h7H,6H2,1-5H3 |
| InChIKey | ONENYRRFQUYORI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|