C9H6F12O2 — CID 13155363
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl acetate (PubChem CID 13155363) has the molecular formula C9H6F12O2 and a molecular weight of 374.12 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl acetate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl acetate |
|---|---|
| PubChem CID | 13155363 |
| Molecular Formula | C9H6F12O2 |
| Molecular Weight | 374.12 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl acetate |
| SMILES | CC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H6F12O2/c1-3(22)23-2-5(12,13)7(16,17)9(20,21)8(18,19)6(14,15)4(10)11/h4H,2H2,1H3 |
| InChIKey | YFKRSKWHZRXBQJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.12 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|