C25H38F12O2 — CID 139714182
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-heptylundecanoate (PubChem CID 139714182) has the molecular formula C25H38F12O2 and a molecular weight of 598.55 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-heptylundecanoate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-heptylundecanoate |
|---|---|
| PubChem CID | 139714182 |
| Molecular Formula | C25H38F12O2 |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-heptylundecanoate |
| SMILES | CCCCCCCCCC(CCCCCCC)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C25H38F12O2/c1-3-5-7-9-10-12-14-16-18(15-13-11-8-6-4-2)19(38)39-17-21(28,29)23(32,33)25(36,37)24(34,35)22(30,31)20(26)27/h18,20H,3-17H2,1-2H3 |
| InChIKey | ARYOKFFRBKZAGP-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|