C28H40F16O2 — CID 139714172
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecyl 2-heptylundecanoate (PubChem CID 139714172) has the molecular formula C28H40F16O2 and a molecular weight of 712.59 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecyl 2-heptylundecanoate.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecyl 2-heptylundecanoate |
|---|---|
| PubChem CID | 139714172 |
| Molecular Formula | C28H40F16O2 |
| Molecular Weight | 712.59 g/mol |
| Exact Mass | 712.28 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecyl 2-heptylundecanoate |
| SMILES | CCCCCCCCCC(CCCCCCC)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C28H40F16O2/c1-3-5-7-9-10-12-14-16-19(15-13-11-8-6-4-2)20(45)46-18-17-22(31,32)24(35,36)26(39,40)28(43,44)27(41,42)25(37,38)23(33,34)21(29)30/h19,21H,3-18H2,1-2H3 |
| InChIKey | ULLCSWFYWWVDSZ-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.59 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|