C28H38F16O2 — CID 139714175
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecyl (Z)-octadec-9-enoate (PubChem CID 139714175) has the molecular formula C28H38F16O2 and a molecular weight of 710.58 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecyl (Z)-octadec-9-enoate.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 139714175 |
| Molecular Formula | C28H38F16O2 |
| Molecular Weight | 710.58 g/mol |
| Exact Mass | 710.26 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C28H38F16O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(45)46-19-18-22(31,32)24(35,36)26(39,40)28(43,44)27(41,42)25(37,38)23(33,34)21(29)30/h9-10,21H,2-8,11-19H2,1H3/b10-9- |
| InChIKey | MHAPPLVSXVUMAO-KTKRTIGZSA-N |
| XLogP | 11.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.58 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|