C25H32F12O2 — CID 139714173
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 139714173) has the molecular formula C25H32F12O2 and a molecular weight of 592.51 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 139714173 |
| Molecular Formula | C25H32F12O2 |
| Molecular Weight | 592.51 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C25H32F12O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(38)39-18-21(28,29)23(32,33)25(36,37)24(34,35)22(30,31)20(26)27/h3-4,6-7,9-10,20H,2,5,8,11-18H2,1H3/b4-3-,7-6-,10-9- |
| InChIKey | OVFRGOVZAUIONB-PDBXOOCHSA-N |
| XLogP | 9.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.51 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|