C37H64O6 — CID 90916326
[2-hydroxy-2-(octanoyloxymethyl)-3-oxoicosa-11,14,17-trienyl] octanoate (PubChem CID 90916326) has the molecular formula C37H64O6 and a molecular weight of 604.91 g/mol. Its IUPAC name is [2-hydroxy-2-(octanoyloxymethyl)-3-oxoicosa-11,14,17-trienyl] octanoate.
| Compound Name | [2-hydroxy-2-(octanoyloxymethyl)-3-oxoicosa-11,14,17-trienyl] octanoate |
|---|---|
| PubChem CID | 90916326 |
| Molecular Formula | C37H64O6 |
| Molecular Weight | 604.91 g/mol |
| Exact Mass | 604.47 |
| IUPAC Name | [2-hydroxy-2-(octanoyloxymethyl)-3-oxoicosa-11,14,17-trienyl] octanoate |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(=O)C(O)(COC(=O)CCCCCCC)COC(=O)CCCCCCC |
| InChI | InChI=1S/C37H64O6/c1-4-7-10-13-14-15-16-17-18-19-20-21-22-25-26-29-34(38)37(41,32-42-35(39)30-27-23-11-8-5-2)33-43-36(40)31-28-24-12-9-6-3/h7,10,14-15,17-18,41H,4-6,8-9,11-13,16,19-33H2,1-3H3 |
| InChIKey | PTZSSOTYCLBZJV-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.91 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|