C45H80O4 — CID 154338142
[2-ethyl-2-(octadeca-9,12-dienoyloxymethyl)hexyl] octadeca-9,12-dienoate (PubChem CID 154338142) has the molecular formula C45H80O4 and a molecular weight of 685.13 g/mol. Its IUPAC name is [2-ethyl-2-(octadeca-9,12-dienoyloxymethyl)hexyl] octadeca-9,12-dienoate.
| Compound Name | [2-ethyl-2-(octadeca-9,12-dienoyloxymethyl)hexyl] octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 154338142 |
| Molecular Formula | C45H80O4 |
| Molecular Weight | 685.13 g/mol |
| Exact Mass | 684.61 |
| IUPAC Name | [2-ethyl-2-(octadeca-9,12-dienoyloxymethyl)hexyl] octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OCC(CC)(CCCC)COC(=O)CCCCCCCC=CCC=CCCCCC |
| InChI | InChI=1S/C45H80O4/c1-5-9-12-14-16-18-20-22-24-26-28-30-32-34-36-38-43(46)48-41-45(8-4,40-11-7-3)42-49-44(47)39-37-35-33-31-29-27-25-23-21-19-17-15-13-10-6-2/h16-19,22-25H,5-15,20-21,26-42H2,1-4H3 |
| InChIKey | NPMUIBABWADCCN-UHFFFAOYSA-N |
| XLogP | 14.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.13 |
| LogP ≤ 5 | 14.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|