C59H107NO2 — CID 137355845
[(11Z,14Z)-2-[(dimethylamino)methyl]-2-octadeca-9,12-dienylicosa-11,14-dienyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 137355845) has the molecular formula C59H107NO2 and a molecular weight of 862.51 g/mol. Its IUPAC name is [(11Z,14Z)-2-[(dimethylamino)methyl]-2-octadeca-9,12-dienylicosa-11,14-dienyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [(11Z,14Z)-2-[(dimethylamino)methyl]-2-octadeca-9,12-dienylicosa-11,14-dienyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 137355845 |
| Molecular Formula | C59H107NO2 |
| Molecular Weight | 862.51 g/mol |
| Exact Mass | 861.83 |
| IUPAC Name | [(11Z,14Z)-2-[(dimethylamino)methyl]-2-octadeca-9,12-dienylicosa-11,14-dienyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)(COC(=O)CCCCCCC/C=C\C/C=C\CCCCC)CN(C)C |
| InChI | InChI=1S/C59H107NO2/c1-6-9-12-15-18-21-24-27-30-33-36-39-42-45-48-51-54-59(56-60(4)5,55-52-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-2)57-62-58(61)53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-3/h18-23,27-32H,6-17,24-26,33-57H2,1-5H3/b21-18-,22-19?,23-20-,30-27-,31-28?,32-29- |
| InChIKey | HIMXIJQHMALDPV-NETQBDISSA-N |
| XLogP | 19.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.51 |
| LogP ≤ 5 | 19.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|