C46H85NO3 — CID 142497088
[(14Z,17Z)-5-hydroxy-5-[(9Z,12Z)-octadeca-9,12-dienyl]tricosa-14,17-dienyl] 3-(dimethylamino)propanoate (PubChem CID 142497088) has the molecular formula C46H85NO3 and a molecular weight of 700.19 g/mol. Its IUPAC name is [(14Z,17Z)-5-hydroxy-5-[(9Z,12Z)-octadeca-9,12-dienyl]tricosa-14,17-dienyl] 3-(dimethylamino)propanoate.
| Compound Name | [(14Z,17Z)-5-hydroxy-5-[(9Z,12Z)-octadeca-9,12-dienyl]tricosa-14,17-dienyl] 3-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 142497088 |
| Molecular Formula | C46H85NO3 |
| Molecular Weight | 700.19 g/mol |
| Exact Mass | 699.65 |
| IUPAC Name | [(14Z,17Z)-5-hydroxy-5-[(9Z,12Z)-octadeca-9,12-dienyl]tricosa-14,17-dienyl] 3-(dimethylamino)propanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(O)(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCOC(=O)CCN(C)C |
| InChI | InChI=1S/C46H85NO3/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40-46(49,42-37-38-44-50-45(48)39-43-47(3)4)41-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,49H,5-12,17-18,23-44H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | IGVUKHJIQOOWAW-KWXKLSQISA-N |
| XLogP | 13.79 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.19 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|