C48H89NO3 — CID 146502966
[(14Z,17Z)-5-hydroxy-5-octadeca-9,12-dienyltricosa-14,17-dienyl] 3-(diethylamino)propanoate (PubChem CID 146502966) has the molecular formula C48H89NO3 and a molecular weight of 728.24 g/mol. Its IUPAC name is [(14Z,17Z)-5-hydroxy-5-octadeca-9,12-dienyltricosa-14,17-dienyl] 3-(diethylamino)propanoate.
| Compound Name | [(14Z,17Z)-5-hydroxy-5-octadeca-9,12-dienyltricosa-14,17-dienyl] 3-(diethylamino)propanoate |
|---|---|
| PubChem CID | 146502966 |
| Molecular Formula | C48H89NO3 |
| Molecular Weight | 728.24 g/mol |
| Exact Mass | 727.68 |
| IUPAC Name | [(14Z,17Z)-5-hydroxy-5-octadeca-9,12-dienyltricosa-14,17-dienyl] 3-(diethylamino)propanoate |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(O)(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCOC(=O)CCN(CC)CC |
| InChI | InChI=1S/C48H89NO3/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-42-48(51,44-39-40-46-52-47(50)41-45-49(7-3)8-4)43-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2/h15-18,21-24,51H,5-14,19-20,25-46H2,1-4H3/b17-15-,18-16?,23-21-,24-22? |
| InChIKey | LJYDAKQDEUREQP-STVVEGHUSA-N |
| XLogP | 14.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.24 |
| LogP ≤ 5 | 14.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|