C43H79NO2 — CID 58069768
[(6Z,9Z,28Z,31Z)-19-methylheptatriaconta-6,9,28,31-tetraen-19-yl] 3-(dimethylamino)propanoate (PubChem CID 58069768) has the molecular formula C43H79NO2 and a molecular weight of 642.11 g/mol. Its IUPAC name is [(6Z,9Z,28Z,31Z)-19-methylheptatriaconta-6,9,28,31-tetraen-19-yl] 3-(dimethylamino)propanoate.
| Compound Name | [(6Z,9Z,28Z,31Z)-19-methylheptatriaconta-6,9,28,31-tetraen-19-yl] 3-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 58069768 |
| Molecular Formula | C43H79NO2 |
| Molecular Weight | 642.11 g/mol |
| Exact Mass | 641.61 |
| IUPAC Name | [(6Z,9Z,28Z,31Z)-19-methylheptatriaconta-6,9,28,31-tetraen-19-yl] 3-(dimethylamino)propanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(C)(CCCCCCCC/C=C\C/C=C\CCCCC)OC(=O)CCN(C)C |
| InChI | InChI=1S/C43H79NO2/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-39-43(3,46-42(45)38-41-44(4)5)40-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23H,6-13,18-19,24-41H2,1-5H3/b16-14-,17-15-,22-20-,23-21- |
| InChIKey | XNOXSOKEMXFKHB-ZPPAUJSGSA-N |
| XLogP | 13.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.11 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|