C45H83NO — CID 76830331
1-(dimethylamino)-6-methyl-6-octadeca-9,12-dienyltetracosa-15,18-dien-4-one (PubChem CID 76830331) has the molecular formula C45H83NO and a molecular weight of 654.16 g/mol. Its IUPAC name is 1-(dimethylamino)-6-methyl-6-octadeca-9,12-dienyltetracosa-15,18-dien-4-one.
| Compound Name | 1-(dimethylamino)-6-methyl-6-octadeca-9,12-dienyltetracosa-15,18-dien-4-one |
|---|---|
| PubChem CID | 76830331 |
| Molecular Formula | C45H83NO |
| Molecular Weight | 654.16 g/mol |
| Exact Mass | 653.65 |
| IUPAC Name | 1-(dimethylamino)-6-methyl-6-octadeca-9,12-dienyltetracosa-15,18-dien-4-one |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(C)(CCCCCCCCC=CCC=CCCCCC)CC(=O)CCCN(C)C |
| InChI | InChI=1S/C45H83NO/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-40-45(3,43-44(47)39-38-42-46(4)5)41-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23H,6-13,18-19,24-43H2,1-5H3 |
| InChIKey | KVHWQBFEDGURPY-UHFFFAOYSA-N |
| XLogP | 14.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.16 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|