C62H113NO3 — CID 88549177
[(6Z,9Z,29Z,32Z)-20-hydroxy-20-[(9Z,12Z)-octadeca-9,12-dienyl]octatriaconta-6,9,29,32-tetraen-19-yl] 4-(dimethylamino)butanoate (PubChem CID 88549177) has the molecular formula C62H113NO3 and a molecular weight of 920.59 g/mol. Its IUPAC name is [(6Z,9Z,29Z,32Z)-20-hydroxy-20-[(9Z,12Z)-octadeca-9,12-dienyl]octatriaconta-6,9,29,32-tetraen-19-yl] 4-(dimethylamino)butanoate.
| Compound Name | [(6Z,9Z,29Z,32Z)-20-hydroxy-20-[(9Z,12Z)-octadeca-9,12-dienyl]octatriaconta-6,9,29,32-tetraen-19-yl] 4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 88549177 |
| Molecular Formula | C62H113NO3 |
| Molecular Weight | 920.59 g/mol |
| Exact Mass | 919.87 |
| IUPAC Name | [(6Z,9Z,29Z,32Z)-20-hydroxy-20-[(9Z,12Z)-octadeca-9,12-dienyl]octatriaconta-6,9,29,32-tetraen-19-yl] 4-(dimethylamino)butanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(OC(=O)CCCN(C)C)C(O)(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C62H113NO3/c1-6-9-12-15-18-21-24-27-30-33-36-39-42-45-48-51-55-60(66-61(64)56-54-59-63(4)5)62(65,57-52-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-2)58-53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-3/h18-23,27-32,60,65H,6-17,24-26,33-59H2,1-5H3/b21-18-,22-19-,23-20-,30-27-,31-28-,32-29- |
| InChIKey | IVFBGIUZYMLXCK-CWJLHRMTSA-N |
| XLogP | 19.58 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.59 |
| LogP ≤ 5 | 19.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|