C41H73NO3 — CID 86684837
[(6Z,9Z,27Z,30Z)-19-oxohexatriaconta-6,9,27,30-tetraen-18-yl] 3-(dimethylamino)propanoate (PubChem CID 86684837) has the molecular formula C41H73NO3 and a molecular weight of 628.04 g/mol. Its IUPAC name is [(6Z,9Z,27Z,30Z)-19-oxohexatriaconta-6,9,27,30-tetraen-18-yl] 3-(dimethylamino)propanoate.
| Compound Name | [(6Z,9Z,27Z,30Z)-19-oxohexatriaconta-6,9,27,30-tetraen-18-yl] 3-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 86684837 |
| Molecular Formula | C41H73NO3 |
| Molecular Weight | 628.04 g/mol |
| Exact Mass | 627.56 |
| IUPAC Name | [(6Z,9Z,27Z,30Z)-19-oxohexatriaconta-6,9,27,30-tetraen-18-yl] 3-(dimethylamino)propanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)C(CCCCCCC/C=C\C/C=C\CCCCC)OC(=O)CCN(C)C |
| InChI | InChI=1S/C41H73NO3/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39(43)40(45-41(44)37-38-42(3)4)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,40H,5-12,17-18,23-38H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | GQWNXDVMFGMOCO-KWXKLSQISA-N |
| XLogP | 12.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.04 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|