C65H113NO8 — CID 170917988
[2-[4-(dimethylamino)butanoyloxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]oxymethyl]propyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 170917988) has the molecular formula C65H113NO8 and a molecular weight of 1036.62 g/mol. Its IUPAC name is [2-[4-(dimethylamino)butanoyloxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]oxymethyl]propyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-[4-(dimethylamino)butanoyloxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]oxymethyl]propyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 170917988 |
| Molecular Formula | C65H113NO8 |
| Molecular Weight | 1036.62 g/mol |
| Exact Mass | 1035.85 |
| IUPAC Name | [2-[4-(dimethylamino)butanoyloxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]oxymethyl]propyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\C/C=C\CCCCC)(COC(=O)CCCCCCC/C=C\C/C=C\CCCCC)COC(=O)CCCN(C)C |
| InChI | InChI=1S/C65H113NO8/c1-6-9-12-15-18-21-24-27-30-33-36-39-42-45-48-52-61(67)71-57-65(60-74-64(70)55-51-56-66(4)5,58-72-62(68)53-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-2)59-73-63(69)54-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-3/h18-23,27-32H,6-17,24-26,33-60H2,1-5H3/b21-18-,22-19-,23-20-,30-27-,31-28-,32-29- |
| InChIKey | NZNAUVRGVKMCOE-CWJLHRMTSA-N |
| XLogP | 17.93 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1036.62 |
| LogP ≤ 5 | 17.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|