C44H78N2O5 — CID 155015588
2-[4-(dimethylamino)butanoyl-[2-[(8E,10E)-hexadeca-8,10-dienoyl]oxyethyl]amino]ethyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 155015588) has the molecular formula C44H78N2O5 and a molecular weight of 715.12 g/mol. Its IUPAC name is 2-[4-(dimethylamino)butanoyl-[2-[(8E,10E)-hexadeca-8,10-dienoyl]oxyethyl]amino]ethyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 2-[4-(dimethylamino)butanoyl-[2-[(8E,10E)-hexadeca-8,10-dienoyl]oxyethyl]amino]ethyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 155015588 |
| Molecular Formula | C44H78N2O5 |
| Molecular Weight | 715.12 g/mol |
| Exact Mass | 714.59 |
| IUPAC Name | 2-[4-(dimethylamino)butanoyl-[2-[(8E,10E)-hexadeca-8,10-dienoyl]oxyethyl]amino]ethyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCN(CCOC(=O)CCCCCC/C=C/C=C/CCCCC)C(=O)CCCN(C)C |
| InChI | InChI=1S/C44H78N2O5/c1-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-36-44(49)51-41-39-46(42(47)34-33-37-45(3)4)38-40-50-43(48)35-31-29-27-25-23-21-18-16-14-12-10-8-6-2/h13-16,18-21H,5-12,17,22-41H2,1-4H3/b15-13-,16-14+,20-19-,21-18+ |
| InChIKey | MUOBDADYOROITJ-YPHOGWQISA-N |
| XLogP | 11.09 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.12 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|