C46H82N2O5S — CID 123418607
2-[[2-[2-(dimethylamino)ethylsulfanyl]acetyl]-(2-octadeca-9,12-dienoyloxyethyl)amino]ethyl octadeca-9,12-dienoate (PubChem CID 123418607) has the molecular formula C46H82N2O5S and a molecular weight of 775.24 g/mol. Its IUPAC name is 2-[[2-[2-(dimethylamino)ethylsulfanyl]acetyl]-(2-octadeca-9,12-dienoyloxyethyl)amino]ethyl octadeca-9,12-dienoate.
| Compound Name | 2-[[2-[2-(dimethylamino)ethylsulfanyl]acetyl]-(2-octadeca-9,12-dienoyloxyethyl)amino]ethyl octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 123418607 |
| Molecular Formula | C46H82N2O5S |
| Molecular Weight | 775.24 g/mol |
| Exact Mass | 774.59 |
| IUPAC Name | 2-[[2-[2-(dimethylamino)ethylsulfanyl]acetyl]-(2-octadeca-9,12-dienoyloxyethyl)amino]ethyl octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OCCN(CCOC(=O)CCCCCCCC=CCC=CCCCCC)C(=O)CSCCN(C)C |
| InChI | InChI=1S/C46H82N2O5S/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-45(50)52-40-37-48(44(49)43-54-42-39-47(3)4)38-41-53-46(51)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22H,5-12,17-18,23-43H2,1-4H3 |
| InChIKey | DPRFTTLDPFNYMX-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.24 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|